C11H11BrF3NOS — CID 43077513
N-[4-bromo-3-(trifluoromethyl)phenyl]-2-methylsulfanylpropanamide (PubChem CID 43077513) has the molecular formula C11H11BrF3NOS and a molecular weight of 342.18 g/mol. Its IUPAC name is N-[4-bromo-3-(trifluoromethyl)phenyl]-2-methylsulfanylpropanamide.
| Compound Name | N-[4-bromo-3-(trifluoromethyl)phenyl]-2-methylsulfanylpropanamide |
|---|---|
| PubChem CID | 43077513 |
| Molecular Formula | C11H11BrF3NOS |
| Molecular Weight | 342.18 g/mol |
| Exact Mass | 340.97 |
| IUPAC Name | N-[4-bromo-3-(trifluoromethyl)phenyl]-2-methylsulfanylpropanamide |
| SMILES | CSC(C)C(=O)Nc1ccc(Br)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H11BrF3NOS/c1-6(18-2)10(17)16-7-3-4-9(12)8(5-7)11(13,14)15/h3-6H,1-2H3,(H,16,17) |
| InChIKey | LVWNFYNRVLBLHB-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.18 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |