C13H16BrF3N2O — CID 62852165
N-[4-bromo-3-(trifluoromethyl)phenyl]-3-(ethylamino)-2-methylpropanamide (PubChem CID 62852165) has the molecular formula C13H16BrF3N2O and a molecular weight of 353.18 g/mol. Its IUPAC name is N-[4-bromo-3-(trifluoromethyl)phenyl]-3-(ethylamino)-2-methylpropanamide.
| Compound Name | N-[4-bromo-3-(trifluoromethyl)phenyl]-3-(ethylamino)-2-methylpropanamide |
|---|---|
| PubChem CID | 62852165 |
| Molecular Formula | C13H16BrF3N2O |
| Molecular Weight | 353.18 g/mol |
| Exact Mass | 352.04 |
| IUPAC Name | N-[4-bromo-3-(trifluoromethyl)phenyl]-3-(ethylamino)-2-methylpropanamide |
| SMILES | CCNCC(C)C(=O)Nc1ccc(Br)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H16BrF3N2O/c1-3-18-7-8(2)12(20)19-9-4-5-11(14)10(6-9)13(15,16)17/h4-6,8,18H,3,7H2,1-2H3,(H,19,20) |
| InChIKey | YFNAMMZOPNCSCJ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.18 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |