C11H10BrClF3NO — CID 62727569
N-[4-bromo-3-(trifluoromethyl)phenyl]-3-chloro-2-methylpropanamide (PubChem CID 62727569) has the molecular formula C11H10BrClF3NO and a molecular weight of 344.56 g/mol. Its IUPAC name is N-[4-bromo-3-(trifluoromethyl)phenyl]-3-chloro-2-methylpropanamide.
| Compound Name | N-[4-bromo-3-(trifluoromethyl)phenyl]-3-chloro-2-methylpropanamide |
|---|---|
| PubChem CID | 62727569 |
| Molecular Formula | C11H10BrClF3NO |
| Molecular Weight | 344.56 g/mol |
| Exact Mass | 342.96 |
| IUPAC Name | N-[4-bromo-3-(trifluoromethyl)phenyl]-3-chloro-2-methylpropanamide |
| SMILES | CC(CCl)C(=O)Nc1ccc(Br)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H10BrClF3NO/c1-6(5-13)10(18)17-7-2-3-9(12)8(4-7)11(14,15)16/h2-4,6H,5H2,1H3,(H,17,18) |
| InChIKey | HEOFEKZNEZPXPR-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.56 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|