C13H11BrF3NO3 — CID 120974356
2-[[4-bromo-3-(trifluoromethyl)phenyl]carbamoyl]cyclobutane-1-carboxylic acid (PubChem CID 120974356) has the molecular formula C13H11BrF3NO3 and a molecular weight of 366.13 g/mol. Its IUPAC name is 2-[[4-bromo-3-(trifluoromethyl)phenyl]carbamoyl]cyclobutane-1-carboxylic acid.
| Compound Name | 2-[[4-bromo-3-(trifluoromethyl)phenyl]carbamoyl]cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 120974356 |
| Molecular Formula | C13H11BrF3NO3 |
| Molecular Weight | 366.13 g/mol |
| Exact Mass | 364.99 |
| IUPAC Name | 2-[[4-bromo-3-(trifluoromethyl)phenyl]carbamoyl]cyclobutane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC1C(=O)Nc1ccc(Br)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H11BrF3NO3/c14-10-4-1-6(5-9(10)13(15,16)17)18-11(19)7-2-3-8(7)12(20)21/h1,4-5,7-8H,2-3H2,(H,18,19)(H,20,21) |
| InChIKey | YZRCBMGIRFDAIV-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.13 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |