C12H11BrF3NO2 — CID 103254014
2-[4-bromo-3-(trifluoromethyl)anilino]cyclobutane-1-carboxylic acid (PubChem CID 103254014) has the molecular formula C12H11BrF3NO2 and a molecular weight of 338.12 g/mol. Its IUPAC name is 2-[4-bromo-3-(trifluoromethyl)anilino]cyclobutane-1-carboxylic acid.
| Compound Name | 2-[4-bromo-3-(trifluoromethyl)anilino]cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 103254014 |
| Molecular Formula | C12H11BrF3NO2 |
| Molecular Weight | 338.12 g/mol |
| Exact Mass | 336.99 |
| IUPAC Name | 2-[4-bromo-3-(trifluoromethyl)anilino]cyclobutane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC1Nc1ccc(Br)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H11BrF3NO2/c13-9-3-1-6(5-8(9)12(14,15)16)17-10-4-2-7(10)11(18)19/h1,3,5,7,10,17H,2,4H2,(H,18,19) |
| InChIKey | YIDISWJCLFVJOE-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.12 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |