C16H19BrF3N — CID 64595837
4-bromo-N-(3-cyclopropylcyclohexyl)-3-(trifluoromethyl)aniline (PubChem CID 64595837) has the molecular formula C16H19BrF3N and a molecular weight of 362.23 g/mol. Its IUPAC name is 4-bromo-N-(3-cyclopropylcyclohexyl)-3-(trifluoromethyl)aniline.
| Compound Name | 4-bromo-N-(3-cyclopropylcyclohexyl)-3-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 64595837 |
| Molecular Formula | C16H19BrF3N |
| Molecular Weight | 362.23 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | 4-bromo-N-(3-cyclopropylcyclohexyl)-3-(trifluoromethyl)aniline |
| SMILES | FC(F)(F)c1cc(NC2CCCC(C3CC3)C2)ccc1Br |
| InChI | InChI=1S/C16H19BrF3N/c17-15-7-6-13(9-14(15)16(18,19)20)21-12-3-1-2-11(8-12)10-4-5-10/h6-7,9-12,21H,1-5,8H2 |
| InChIKey | UVWDGMSPKJQOTI-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.23 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |