C13H13BrF3N — CID 107907073
4-bromo-N-cyclohex-2-en-1-yl-3-(trifluoromethyl)aniline (PubChem CID 107907073) has the molecular formula C13H13BrF3N and a molecular weight of 320.15 g/mol. Its IUPAC name is 4-bromo-N-cyclohex-2-en-1-yl-3-(trifluoromethyl)aniline.
| Compound Name | 4-bromo-N-cyclohex-2-en-1-yl-3-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 107907073 |
| Molecular Formula | C13H13BrF3N |
| Molecular Weight | 320.15 g/mol |
| Exact Mass | 319.02 |
| IUPAC Name | 4-bromo-N-cyclohex-2-en-1-yl-3-(trifluoromethyl)aniline |
| SMILES | FC(F)(F)c1cc(NC2C=CCCC2)ccc1Br |
| InChI | InChI=1S/C13H13BrF3N/c14-12-7-6-10(8-11(12)13(15,16)17)18-9-4-2-1-3-5-9/h2,4,6-9,18H,1,3,5H2 |
| InChIKey | GTWRPNPONQMXBH-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.15 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|