About (2Z)-N-[3,5-bis(trifluoromethyl)phenyl]cyclooct-2-en-1-amine
(2Z)-N-[3,5-bis(trifluoromethyl)phenyl]cyclooct-2-en-1-amine (PubChem CID 132500493) has the molecular formula C16H17F6N
and a molecular weight of 337.31 g/mol. Its IUPAC name is (2Z)-N-[3,5-bis(trifluoromethyl)phenyl]cyclooct-2-en-1-amine.
Molecular Properties
| Compound Name | (2Z)-N-[3,5-bis(trifluoromethyl)phenyl]cyclooct-2-en-1-amine |
| PubChem CID | 132500493 |
| Molecular Formula | C16H17F6N |
| Molecular Weight | 337.31 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | (2Z)-N-[3,5-bis(trifluoromethyl)phenyl]cyclooct-2-en-1-amine |
| SMILES | FC(F)(F)c1cc(NC2/C=C\CCCCC2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H17F6N/c17-15(18,19)11-8-12(16(20,21)22)10-14(9-11)23-13-6-4-2-1-3-5-7-13/h4,6,8-10,13,23H,1-3,5,7H2/b6-4- |
| InChIKey | KCOGVZNDUBMLAB-XQRVVYSFSA-N |
| XLogP | 6.03 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 337.31 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-N-[3,5-bis(trifluoromethyl)phenyl]cyclooct-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-N-[3,5-bis(trifluoromethyl)phenyl]cyclooct-2-en-1-amine?
The IUPAC name of (2Z)-N-[3,5-bis(trifluoromethyl)phenyl]cyclooct-2-en-1-amine (CID 132500493) is (2Z)-N-[3,5-bis(trifluoromethyl)phenyl]cyclooct-2-en-1-amine.
What is the SMILES notation for (2Z)-N-[3,5-bis(trifluoromethyl)phenyl]cyclooct-2-en-1-amine?
The canonical SMILES for (2Z)-N-[3,5-bis(trifluoromethyl)phenyl]cyclooct-2-en-1-amine is FC(F)(F)c1cc(NC2/C=C\CCCCC2)cc(C(F)(F)F)c1.
What is the InChIKey of (2Z)-N-[3,5-bis(trifluoromethyl)phenyl]cyclooct-2-en-1-amine?
The InChIKey is KCOGVZNDUBMLAB-XQRVVYSFSA-N. The full InChI is InChI=1S/C16H17F6N/c17-15(18,19)11-8-12(16(20,21)22)10-14(9-11)23-13-6-4-2-1-3-5-7-13/h4,6,8-10,13,23H,1-3,5,7H2/b6-4-.
What are the key properties of (2Z)-N-[3,5-bis(trifluoromethyl)phenyl]cyclooct-2-en-1-amine?
(2Z)-N-[3,5-bis(trifluoromethyl)phenyl]cyclooct-2-en-1-amine has a molecular weight of 337.31 g/mol, XLogP of 6.03, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-N-[3,5-bis(trifluoromethyl)phenyl]cyclooct-2-en-1-amine is sourced from PubChem (CID 132500493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).