C16H15F6N — CID 132500495
(2Z,5Z)-N-[3,5-bis(trifluoromethyl)phenyl]cycloocta-2,5-dien-1-amine (PubChem CID 132500495) has the molecular formula C16H15F6N and a molecular weight of 335.29 g/mol. Its IUPAC name is (2Z,5Z)-N-[3,5-bis(trifluoromethyl)phenyl]cycloocta-2,5-dien-1-amine.
| Compound Name | (2Z,5Z)-N-[3,5-bis(trifluoromethyl)phenyl]cycloocta-2,5-dien-1-amine |
|---|---|
| PubChem CID | 132500495 |
| Molecular Formula | C16H15F6N |
| Molecular Weight | 335.29 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | (2Z,5Z)-N-[3,5-bis(trifluoromethyl)phenyl]cycloocta-2,5-dien-1-amine |
| SMILES | FC(F)(F)c1cc(NC2/C=C\C/C=C\CC2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H15F6N/c17-15(18,19)11-8-12(16(20,21)22)10-14(9-11)23-13-6-4-2-1-3-5-7-13/h1-2,5,7-10,13,23H,3-4,6H2/b2-1-,7-5- |
| InChIKey | QURNGAUTPZLDDC-PQZOIKATSA-N |
| XLogP | 5.80 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.29 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|