About 3-[3,5-bis(trifluoromethyl)anilino]-1,2-dihydropyrrol-5-one
3-[3,5-bis(trifluoromethyl)anilino]-1,2-dihydropyrrol-5-one (PubChem CID 139933599) has the molecular formula C12H8F6N2O
and a molecular weight of 310.20 g/mol. Its IUPAC name is 3-[3,5-bis(trifluoromethyl)anilino]-1,2-dihydropyrrol-5-one.
Molecular Properties
| Compound Name | 3-[3,5-bis(trifluoromethyl)anilino]-1,2-dihydropyrrol-5-one |
| PubChem CID | 139933599 |
| Molecular Formula | C12H8F6N2O |
| Molecular Weight | 310.20 g/mol |
| Exact Mass | 310.05 |
| IUPAC Name | 3-[3,5-bis(trifluoromethyl)anilino]-1,2-dihydropyrrol-5-one |
| SMILES | O=C1C=C(Nc2cc(C(F)(F)F)cc(C(F)(F)F)c2)CN1 |
| InChI | InChI=1S/C12H8F6N2O/c13-11(14,15)6-1-7(12(16,17)18)3-8(2-6)20-9-4-10(21)19-5-9/h1-4,20H,5H2,(H,19,21) |
| InChIKey | QYRUTXWJSFHXSE-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.20 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[3,5-bis(trifluoromethyl)anilino]-1,2-dihydropyrrol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3,5-bis(trifluoromethyl)anilino]-1,2-dihydropyrrol-5-one?
The IUPAC name of 3-[3,5-bis(trifluoromethyl)anilino]-1,2-dihydropyrrol-5-one (CID 139933599) is 3-[3,5-bis(trifluoromethyl)anilino]-1,2-dihydropyrrol-5-one.
What is the SMILES notation for 3-[3,5-bis(trifluoromethyl)anilino]-1,2-dihydropyrrol-5-one?
The canonical SMILES for 3-[3,5-bis(trifluoromethyl)anilino]-1,2-dihydropyrrol-5-one is O=C1C=C(Nc2cc(C(F)(F)F)cc(C(F)(F)F)c2)CN1.
What is the InChIKey of 3-[3,5-bis(trifluoromethyl)anilino]-1,2-dihydropyrrol-5-one?
The InChIKey is QYRUTXWJSFHXSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8F6N2O/c13-11(14,15)6-1-7(12(16,17)18)3-8(2-6)20-9-4-10(21)19-5-9/h1-4,20H,5H2,(H,19,21).
What are the key properties of 3-[3,5-bis(trifluoromethyl)anilino]-1,2-dihydropyrrol-5-one?
3-[3,5-bis(trifluoromethyl)anilino]-1,2-dihydropyrrol-5-one has a molecular weight of 310.20 g/mol, XLogP of 3.15, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3,5-bis(trifluoromethyl)anilino]-1,2-dihydropyrrol-5-one is sourced from PubChem (CID 139933599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).