C18H14F12N2Si — CID 18328539
N-[[3,5-bis(trifluoromethyl)anilino]-dimethylsilyl]-3,5-bis(trifluoromethyl)aniline (PubChem CID 18328539) has the molecular formula C18H14F12N2Si and a molecular weight of 514.39 g/mol. Its IUPAC name is N-[[3,5-bis(trifluoromethyl)anilino]-dimethylsilyl]-3,5-bis(trifluoromethyl)aniline.
| Compound Name | N-[[3,5-bis(trifluoromethyl)anilino]-dimethylsilyl]-3,5-bis(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 18328539 |
| Molecular Formula | C18H14F12N2Si |
| Molecular Weight | 514.39 g/mol |
| Exact Mass | 514.07 |
| IUPAC Name | N-[[3,5-bis(trifluoromethyl)anilino]-dimethylsilyl]-3,5-bis(trifluoromethyl)aniline |
| SMILES | C[Si](C)(Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1)Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H14F12N2Si/c1-33(2,31-13-5-9(15(19,20)21)3-10(6-13)16(22,23)24)32-14-7-11(17(25,26)27)4-12(8-14)18(28,29)30/h3-8,31-32H,1-2H3 |
| InChIKey | NRPRNTPHCJZOOH-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.39 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|