C10H7F6N — CID 163887176
N-ethenyl-3,5-bis(trifluoromethyl)aniline (PubChem CID 163887176) has the molecular formula C10H7F6N and a molecular weight of 255.16 g/mol. Its IUPAC name is N-ethenyl-3,5-bis(trifluoromethyl)aniline.
| Compound Name | N-ethenyl-3,5-bis(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 163887176 |
| Molecular Formula | C10H7F6N |
| Molecular Weight | 255.16 g/mol |
| Exact Mass | 255.05 |
| IUPAC Name | N-ethenyl-3,5-bis(trifluoromethyl)aniline |
| SMILES | C=CNc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H7F6N/c1-2-17-8-4-6(9(11,12)13)3-7(5-8)10(14,15)16/h2-5,17H,1H2 |
| InChIKey | PYJSJLRDIKWWKC-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.16 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |