C20H8F12N2S2 — CID 171057092
3,4-bis[3,5-bis(trifluoromethyl)anilino]cyclobut-3-ene-1,2-dithione (PubChem CID 171057092) has the molecular formula C20H8F12N2S2 and a molecular weight of 568.41 g/mol. Its IUPAC name is 3,4-bis[3,5-bis(trifluoromethyl)anilino]cyclobut-3-ene-1,2-dithione.
| Compound Name | 3,4-bis[3,5-bis(trifluoromethyl)anilino]cyclobut-3-ene-1,2-dithione |
|---|---|
| PubChem CID | 171057092 |
| Molecular Formula | C20H8F12N2S2 |
| Molecular Weight | 568.41 g/mol |
| Exact Mass | 567.99 |
| IUPAC Name | 3,4-bis[3,5-bis(trifluoromethyl)anilino]cyclobut-3-ene-1,2-dithione |
| SMILES | FC(F)(F)c1cc(Nc2c(Nc3cc(C(F)(F)F)cc(C(F)(F)F)c3)c(=S)c2=S)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H8F12N2S2/c21-17(22,23)7-1-8(18(24,25)26)4-11(3-7)33-13-14(16(36)15(13)35)34-12-5-9(19(27,28)29)2-10(6-12)20(30,31)32/h1-6,33-34H |
| InChIKey | BVKNQDPFNPPQHK-UHFFFAOYSA-N |
| XLogP | 9.58 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.41 |
| LogP ≤ 5 | 9.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|