C19H14F12N2 — CID 18328560
N,N'-bis[3,5-bis(trifluoromethyl)phenyl]propane-1,3-diamine (PubChem CID 18328560) has the molecular formula C19H14F12N2 and a molecular weight of 498.31 g/mol. Its IUPAC name is N,N'-bis[3,5-bis(trifluoromethyl)phenyl]propane-1,3-diamine.
| Compound Name | N,N'-bis[3,5-bis(trifluoromethyl)phenyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 18328560 |
| Molecular Formula | C19H14F12N2 |
| Molecular Weight | 498.31 g/mol |
| Exact Mass | 498.10 |
| IUPAC Name | N,N'-bis[3,5-bis(trifluoromethyl)phenyl]propane-1,3-diamine |
| SMILES | FC(F)(F)c1cc(NCCCNc2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H14F12N2/c20-16(21,22)10-4-11(17(23,24)25)7-14(6-10)32-2-1-3-33-15-8-12(18(26,27)28)5-13(9-15)19(29,30)31/h4-9,32-33H,1-3H2 |
| InChIKey | QWANYUZWTIXTCP-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.31 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|