C10H14F3N3 — CID 142477923
3-N-[2-(methylamino)ethyl]-5-(trifluoromethyl)benzene-1,3-diamine (PubChem CID 142477923) has the molecular formula C10H14F3N3 and a molecular weight of 233.24 g/mol. Its IUPAC name is 3-N-[2-(methylamino)ethyl]-5-(trifluoromethyl)benzene-1,3-diamine.
| Compound Name | 3-N-[2-(methylamino)ethyl]-5-(trifluoromethyl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 142477923 |
| Molecular Formula | C10H14F3N3 |
| Molecular Weight | 233.24 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | 3-N-[2-(methylamino)ethyl]-5-(trifluoromethyl)benzene-1,3-diamine |
| SMILES | CNCCNc1cc(N)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H14F3N3/c1-15-2-3-16-9-5-7(10(11,12)13)4-8(14)6-9/h4-6,15-16H,2-3,14H2,1H3 |
| InChIKey | LVAVFFANMJQHPD-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.24 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|