C16H10F10N2 — CID 23368887
3-[2-[3-amino-5-(trifluoromethyl)phenyl]-1,1,2,2-tetrafluoroethyl]-5-(trifluoromethyl)aniline (PubChem CID 23368887) has the molecular formula C16H10F10N2 and a molecular weight of 420.25 g/mol. Its IUPAC name is 3-[2-[3-amino-5-(trifluoromethyl)phenyl]-1,1,2,2-tetrafluoroethyl]-5-(trifluoromethyl)aniline.
| Compound Name | 3-[2-[3-amino-5-(trifluoromethyl)phenyl]-1,1,2,2-tetrafluoroethyl]-5-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 23368887 |
| Molecular Formula | C16H10F10N2 |
| Molecular Weight | 420.25 g/mol |
| Exact Mass | 420.07 |
| IUPAC Name | 3-[2-[3-amino-5-(trifluoromethyl)phenyl]-1,1,2,2-tetrafluoroethyl]-5-(trifluoromethyl)aniline |
| SMILES | Nc1cc(C(F)(F)F)cc(C(F)(F)C(F)(F)c2cc(N)cc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C16H10F10N2/c17-13(18,7-1-9(15(21,22)23)5-11(27)3-7)14(19,20)8-2-10(16(24,25)26)6-12(28)4-8/h1-6H,27-28H2 |
| InChIKey | ZMPUIICNFVSSKZ-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.25 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|