C12H15F3N2S — CID 150774232
3-(1-sulfanylpiperidin-4-yl)-5-(trifluoromethyl)aniline (PubChem CID 150774232) has the molecular formula C12H15F3N2S and a molecular weight of 276.33 g/mol. Its IUPAC name is 3-(1-sulfanylpiperidin-4-yl)-5-(trifluoromethyl)aniline.
| Compound Name | 3-(1-sulfanylpiperidin-4-yl)-5-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 150774232 |
| Molecular Formula | C12H15F3N2S |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | 3-(1-sulfanylpiperidin-4-yl)-5-(trifluoromethyl)aniline |
| SMILES | Nc1cc(C2CCN(S)CC2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H15F3N2S/c13-12(14,15)10-5-9(6-11(16)7-10)8-1-3-17(18)4-2-8/h5-8,18H,1-4,16H2 |
| InChIKey | KANFMSSOHZEHGV-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|