C13H13F6N — CID 45073834
3-[3,5-bis(trifluoromethyl)phenyl]piperidine (PubChem CID 45073834) has the molecular formula C13H13F6N and a molecular weight of 297.24 g/mol. Its IUPAC name is 3-[3,5-bis(trifluoromethyl)phenyl]piperidine.
| Compound Name | 3-[3,5-bis(trifluoromethyl)phenyl]piperidine |
|---|---|
| PubChem CID | 45073834 |
| Molecular Formula | C13H13F6N |
| Molecular Weight | 297.24 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 3-[3,5-bis(trifluoromethyl)phenyl]piperidine |
| SMILES | FC(F)(F)c1cc(C2CCCNC2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H13F6N/c14-12(15,16)10-4-9(8-2-1-3-20-7-8)5-11(6-10)13(17,18)19/h4-6,8,20H,1-3,7H2 |
| InChIKey | GSZOGLXISPWVQW-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.24 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |