C9H11F3N2O — CID 83849509
5-piperidin-3-yl-3-(trifluoromethyl)-1,2-oxazole (PubChem CID 83849509) has the molecular formula C9H11F3N2O and a molecular weight of 220.19 g/mol. Its IUPAC name is 5-piperidin-3-yl-3-(trifluoromethyl)-1,2-oxazole.
| Compound Name | 5-piperidin-3-yl-3-(trifluoromethyl)-1,2-oxazole |
|---|---|
| PubChem CID | 83849509 |
| Molecular Formula | C9H11F3N2O |
| Molecular Weight | 220.19 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 5-piperidin-3-yl-3-(trifluoromethyl)-1,2-oxazole |
| SMILES | FC(F)(F)c1cc(C2CCCNC2)on1 |
| InChI | InChI=1S/C9H11F3N2O/c10-9(11,12)8-4-7(15-14-8)6-2-1-3-13-5-6/h4,6,13H,1-3,5H2 |
| InChIKey | JYZIQXANMQKKBK-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.19 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |