C12H20N4O — CID 115077690
3,5-di(piperidin-3-yl)-1,2,4-oxadiazole (PubChem CID 115077690) has the molecular formula C12H20N4O and a molecular weight of 236.32 g/mol. Its IUPAC name is 3,5-di(piperidin-3-yl)-1,2,4-oxadiazole.
| Compound Name | 3,5-di(piperidin-3-yl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 115077690 |
| Molecular Formula | C12H20N4O |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | 3,5-di(piperidin-3-yl)-1,2,4-oxadiazole |
| SMILES | C1CNCC(c2noc(C3CCCNC3)n2)C1 |
| InChI | InChI=1S/C12H20N4O/c1-3-9(7-13-5-1)11-15-12(17-16-11)10-4-2-6-14-8-10/h9-10,13-14H,1-8H2 |
| InChIKey | IKHFPPDUOVCSHL-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 62.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |