C12H19N3O — CID 63024752
5-cyclopentyl-3-piperidin-3-yl-1,2,4-oxadiazole (PubChem CID 63024752) has the molecular formula C12H19N3O and a molecular weight of 221.30 g/mol. Its IUPAC name is 5-cyclopentyl-3-piperidin-3-yl-1,2,4-oxadiazole.
| Compound Name | 5-cyclopentyl-3-piperidin-3-yl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 63024752 |
| Molecular Formula | C12H19N3O |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.15 |
| IUPAC Name | 5-cyclopentyl-3-piperidin-3-yl-1,2,4-oxadiazole |
| SMILES | C1CNCC(c2noc(C3CCCC3)n2)C1 |
| InChI | InChI=1S/C12H19N3O/c1-2-5-9(4-1)12-14-11(15-16-12)10-6-3-7-13-8-10/h9-10,13H,1-8H2 |
| InChIKey | WWXPUCCMZOQAJU-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |