C9H9F3N4 — CID 145450773
3-N,3-N-bis(methylideneamino)-5-(trifluoromethyl)benzene-1,3-diamine (PubChem CID 145450773) has the molecular formula C9H9F3N4 and a molecular weight of 230.19 g/mol. Its IUPAC name is 3-N,3-N-bis(methylideneamino)-5-(trifluoromethyl)benzene-1,3-diamine.
| Compound Name | 3-N,3-N-bis(methylideneamino)-5-(trifluoromethyl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 145450773 |
| Molecular Formula | C9H9F3N4 |
| Molecular Weight | 230.19 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | 3-N,3-N-bis(methylideneamino)-5-(trifluoromethyl)benzene-1,3-diamine |
| SMILES | C=NN(N=C)c1cc(N)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C9H9F3N4/c1-14-16(15-2)8-4-6(9(10,11)12)3-7(13)5-8/h3-5H,1-2,13H2 |
| InChIKey | SEASTNVVQLLKGR-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 53.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.19 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|