C16H16ClF3N4S — CID 162534720
1-[3-amino-5-(trifluoromethyl)phenyl]-2-(2-chloro-5-methylsulfanylphenyl)-1-methylguanidine (PubChem CID 162534720) has the molecular formula C16H16ClF3N4S and a molecular weight of 388.85 g/mol. Its IUPAC name is 1-[3-amino-5-(trifluoromethyl)phenyl]-2-(2-chloro-5-methylsulfanylphenyl)-1-methylguanidine.
| Compound Name | 1-[3-amino-5-(trifluoromethyl)phenyl]-2-(2-chloro-5-methylsulfanylphenyl)-1-methylguanidine |
|---|---|
| PubChem CID | 162534720 |
| Molecular Formula | C16H16ClF3N4S |
| Molecular Weight | 388.85 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | 1-[3-amino-5-(trifluoromethyl)phenyl]-2-(2-chloro-5-methylsulfanylphenyl)-1-methylguanidine |
| SMILES | CSc1ccc(Cl)c(/N=C(\N)N(C)c2cc(N)cc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C16H16ClF3N4S/c1-24(11-6-9(16(18,19)20)5-10(21)7-11)15(22)23-14-8-12(25-2)3-4-13(14)17/h3-8H,21H2,1-2H3,(H2,22,23) |
| InChIKey | CLVHZMVNXHOMOS-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 67.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.85 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|