C19H16F3N3 — CID 18752006
1-methyl-2-naphthalen-1-yl-1-[3-(trifluoromethyl)phenyl]guanidine (PubChem CID 18752006) has the molecular formula C19H16F3N3 and a molecular weight of 343.35 g/mol. Its IUPAC name is 1-methyl-2-naphthalen-1-yl-1-[3-(trifluoromethyl)phenyl]guanidine.
| Compound Name | 1-methyl-2-naphthalen-1-yl-1-[3-(trifluoromethyl)phenyl]guanidine |
|---|---|
| PubChem CID | 18752006 |
| Molecular Formula | C19H16F3N3 |
| Molecular Weight | 343.35 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | 1-methyl-2-naphthalen-1-yl-1-[3-(trifluoromethyl)phenyl]guanidine |
| SMILES | CN(/C(N)=N/c1cccc2ccccc12)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H16F3N3/c1-25(15-9-5-8-14(12-15)19(20,21)22)18(23)24-17-11-4-7-13-6-2-3-10-16(13)17/h2-12H,1H3,(H2,23,24) |
| InChIKey | JORSWMGATUBEQI-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.35 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|