C17H17BrF3N3 — CID 54370914
2-[2-(2-bromoethyl)phenyl]-1-methyl-1-[3-(trifluoromethyl)phenyl]guanidine (PubChem CID 54370914) has the molecular formula C17H17BrF3N3 and a molecular weight of 400.24 g/mol. Its IUPAC name is 2-[2-(2-bromoethyl)phenyl]-1-methyl-1-[3-(trifluoromethyl)phenyl]guanidine.
| Compound Name | 2-[2-(2-bromoethyl)phenyl]-1-methyl-1-[3-(trifluoromethyl)phenyl]guanidine |
|---|---|
| PubChem CID | 54370914 |
| Molecular Formula | C17H17BrF3N3 |
| Molecular Weight | 400.24 g/mol |
| Exact Mass | 399.06 |
| IUPAC Name | 2-[2-(2-bromoethyl)phenyl]-1-methyl-1-[3-(trifluoromethyl)phenyl]guanidine |
| SMILES | CN(/C(N)=N/c1ccccc1CCBr)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H17BrF3N3/c1-24(14-7-4-6-13(11-14)17(19,20)21)16(22)23-15-8-3-2-5-12(15)9-10-18/h2-8,11H,9-10H2,1H3,(H2,22,23) |
| InChIKey | UTDCDBGZBJOKTM-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.24 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|