C17H18BrClF3N3 — CID 22121786
2-[2-bromo-5-(trifluoromethyl)phenyl]-1-(3-ethylphenyl)-1-methylguanidine;hydrochloride (PubChem CID 22121786) has the molecular formula C17H18BrClF3N3 and a molecular weight of 436.70 g/mol. Its IUPAC name is 2-[2-bromo-5-(trifluoromethyl)phenyl]-1-(3-ethylphenyl)-1-methylguanidine;hydrochloride.
| Compound Name | 2-[2-bromo-5-(trifluoromethyl)phenyl]-1-(3-ethylphenyl)-1-methylguanidine;hydrochloride |
|---|---|
| PubChem CID | 22121786 |
| Molecular Formula | C17H18BrClF3N3 |
| Molecular Weight | 436.70 g/mol |
| Exact Mass | 435.03 |
| IUPAC Name | 2-[2-bromo-5-(trifluoromethyl)phenyl]-1-(3-ethylphenyl)-1-methylguanidine;hydrochloride |
| SMILES | CCc1cccc(N(C)/C(N)=N/c2cc(C(F)(F)F)ccc2Br)c1.Cl |
| InChI | InChI=1S/C17H17BrF3N3.ClH/c1-3-11-5-4-6-13(9-11)24(2)16(22)23-15-10-12(17(19,20)21)7-8-14(15)18;/h4-10H,3H2,1-2H3,(H2,22,23);1H |
| InChIKey | UNRQDMOZWSRHLO-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.70 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|