C18H19BrF3N3 — CID 22120129
1-[2-bromo-5-(trifluoromethyl)phenyl]-3-(3-ethylphenyl)-1,3-dimethylguanidine (PubChem CID 22120129) has the molecular formula C18H19BrF3N3 and a molecular weight of 414.27 g/mol. Its IUPAC name is 1-[2-bromo-5-(trifluoromethyl)phenyl]-3-(3-ethylphenyl)-1,3-dimethylguanidine.
| Compound Name | 1-[2-bromo-5-(trifluoromethyl)phenyl]-3-(3-ethylphenyl)-1,3-dimethylguanidine |
|---|---|
| PubChem CID | 22120129 |
| Molecular Formula | C18H19BrF3N3 |
| Molecular Weight | 414.27 g/mol |
| Exact Mass | 413.07 |
| IUPAC Name | 1-[2-bromo-5-(trifluoromethyl)phenyl]-3-(3-ethylphenyl)-1,3-dimethylguanidine |
| SMILES | [H]/N=C(\N(C)c1cccc(CC)c1)N(C)c1cc(C(F)(F)F)ccc1Br |
| InChI | InChI=1S/C18H19BrF3N3/c1-4-12-6-5-7-14(10-12)24(2)17(23)25(3)16-11-13(18(20,21)22)8-9-15(16)19/h5-11,23H,4H2,1-3H3/b23-17+ |
| InChIKey | VDMKSXWBLFEIMS-HAVVHWLPSA-N |
| XLogP | 5.54 |
| TPSA | 30.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.27 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|