C19H24BrN3 — CID 54037139
1-[2-(2-bromoethyl)phenyl]-3-(3-ethylphenyl)-1,3-dimethylguanidine (PubChem CID 54037139) has the molecular formula C19H24BrN3 and a molecular weight of 374.33 g/mol. Its IUPAC name is 1-[2-(2-bromoethyl)phenyl]-3-(3-ethylphenyl)-1,3-dimethylguanidine.
| Compound Name | 1-[2-(2-bromoethyl)phenyl]-3-(3-ethylphenyl)-1,3-dimethylguanidine |
|---|---|
| PubChem CID | 54037139 |
| Molecular Formula | C19H24BrN3 |
| Molecular Weight | 374.33 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | 1-[2-(2-bromoethyl)phenyl]-3-(3-ethylphenyl)-1,3-dimethylguanidine |
| SMILES | [H]/N=C(\N(C)c1cccc(CC)c1)N(C)c1ccccc1CCBr |
| InChI | InChI=1S/C19H24BrN3/c1-4-15-8-7-10-17(14-15)22(2)19(21)23(3)18-11-6-5-9-16(18)12-13-20/h5-11,14,21H,4,12-13H2,1-3H3/b21-19+ |
| InChIKey | LJTMBVCJTAWOOL-XUTLUUPISA-N |
| XLogP | 4.69 |
| TPSA | 30.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.33 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|