About 1-[2-(2-bromoethyl)phenyl]-3-(3-ethylphenyl)-1,3-dimethylguanidine
1-[2-(2-bromoethyl)phenyl]-3-(3-ethylphenyl)-1,3-dimethylguanidine (PubChem CID 54037139) has the molecular formula C19H24BrN3
and a molecular weight of 374.33 g/mol. Its IUPAC name is 1-[2-(2-bromoethyl)phenyl]-3-(3-ethylphenyl)-1,3-dimethylguanidine.
Molecular Properties
| Compound Name | 1-[2-(2-bromoethyl)phenyl]-3-(3-ethylphenyl)-1,3-dimethylguanidine |
| PubChem CID | 54037139 |
| Molecular Formula | C19H24BrN3 |
| Molecular Weight | 374.33 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | 1-[2-(2-bromoethyl)phenyl]-3-(3-ethylphenyl)-1,3-dimethylguanidine |
| SMILES | [H]/N=C(\N(C)c1cccc(CC)c1)N(C)c1ccccc1CCBr |
| InChI | InChI=1S/C19H24BrN3/c1-4-15-8-7-10-17(14-15)22(2)19(21)23(3)18-11-6-5-9-16(18)12-13-20/h5-11,14,21H,4,12-13H2,1-3H3/b21-19+ |
| InChIKey | LJTMBVCJTAWOOL-XUTLUUPISA-N |
| XLogP | 4.69 |
| TPSA | 30.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.33 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-(2-bromoethyl)phenyl]-3-(3-ethylphenyl)-1,3-dimethylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(2-bromoethyl)phenyl]-3-(3-ethylphenyl)-1,3-dimethylguanidine?
The IUPAC name of 1-[2-(2-bromoethyl)phenyl]-3-(3-ethylphenyl)-1,3-dimethylguanidine (CID 54037139) is 1-[2-(2-bromoethyl)phenyl]-3-(3-ethylphenyl)-1,3-dimethylguanidine.
What is the SMILES notation for 1-[2-(2-bromoethyl)phenyl]-3-(3-ethylphenyl)-1,3-dimethylguanidine?
The canonical SMILES for 1-[2-(2-bromoethyl)phenyl]-3-(3-ethylphenyl)-1,3-dimethylguanidine is [H]/N=C(\N(C)c1cccc(CC)c1)N(C)c1ccccc1CCBr.
What is the InChIKey of 1-[2-(2-bromoethyl)phenyl]-3-(3-ethylphenyl)-1,3-dimethylguanidine?
The InChIKey is LJTMBVCJTAWOOL-XUTLUUPISA-N. The full InChI is InChI=1S/C19H24BrN3/c1-4-15-8-7-10-17(14-15)22(2)19(21)23(3)18-11-6-5-9-16(18)12-13-20/h5-11,14,21H,4,12-13H2,1-3H3/b21-19+.
What are the key properties of 1-[2-(2-bromoethyl)phenyl]-3-(3-ethylphenyl)-1,3-dimethylguanidine?
1-[2-(2-bromoethyl)phenyl]-3-(3-ethylphenyl)-1,3-dimethylguanidine has a molecular weight of 374.33 g/mol, XLogP of 4.69, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(2-bromoethyl)phenyl]-3-(3-ethylphenyl)-1,3-dimethylguanidine is sourced from PubChem (CID 54037139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).