C20H21N3 — CID 18752264
1,3-dimethyl-1-(3-methylphenyl)-3-naphthalen-1-ylguanidine (PubChem CID 18752264) has the molecular formula C20H21N3 and a molecular weight of 303.41 g/mol. Its IUPAC name is 1,3-dimethyl-1-(3-methylphenyl)-3-naphthalen-1-ylguanidine.
| Compound Name | 1,3-dimethyl-1-(3-methylphenyl)-3-naphthalen-1-ylguanidine |
|---|---|
| PubChem CID | 18752264 |
| Molecular Formula | C20H21N3 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | 1,3-dimethyl-1-(3-methylphenyl)-3-naphthalen-1-ylguanidine |
| SMILES | [H]/N=C(\N(C)c1cccc(C)c1)N(C)c1cccc2ccccc12 |
| InChI | InChI=1S/C20H21N3/c1-15-8-6-11-17(14-15)22(2)20(21)23(3)19-13-7-10-16-9-4-5-12-18(16)19/h4-14,21H,1-3H3/b21-20+ |
| InChIKey | MVKDUBDBYBWWMK-QZQOTICOSA-N |
| XLogP | 4.66 |
| TPSA | 30.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|