C19H18N2O — CID 11403549
1,3-dimethyl-1-naphthalen-1-yl-3-phenylurea (PubChem CID 11403549) has the molecular formula C19H18N2O and a molecular weight of 290.37 g/mol. Its IUPAC name is 1,3-dimethyl-1-naphthalen-1-yl-3-phenylurea.
| Compound Name | 1,3-dimethyl-1-naphthalen-1-yl-3-phenylurea |
|---|---|
| PubChem CID | 11403549 |
| Molecular Formula | C19H18N2O |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | 1,3-dimethyl-1-naphthalen-1-yl-3-phenylurea |
| SMILES | CN(C(=O)N(C)c1cccc2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C19H18N2O/c1-20(16-11-4-3-5-12-16)19(22)21(2)18-14-8-10-15-9-6-7-13-17(15)18/h3-14H,1-2H3 |
| InChIKey | GRNLZKVQDVGSFP-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |