C21H22N2O — CID 102087616
1,3-dimethyl-1-naphthalen-1-yl-3-[(1S)-1-phenylethyl]urea (PubChem CID 102087616) has the molecular formula C21H22N2O and a molecular weight of 318.42 g/mol. Its IUPAC name is 1,3-dimethyl-1-naphthalen-1-yl-3-[(1S)-1-phenylethyl]urea.
| Compound Name | 1,3-dimethyl-1-naphthalen-1-yl-3-[(1S)-1-phenylethyl]urea |
|---|---|
| PubChem CID | 102087616 |
| Molecular Formula | C21H22N2O |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | 1,3-dimethyl-1-naphthalen-1-yl-3-[(1S)-1-phenylethyl]urea |
| SMILES | C[C@@H](c1ccccc1)N(C)C(=O)N(C)c1cccc2ccccc12 |
| InChI | InChI=1S/C21H22N2O/c1-16(17-10-5-4-6-11-17)22(2)21(24)23(3)20-15-9-13-18-12-7-8-14-19(18)20/h4-16H,1-3H3/t16-/m0/s1 |
| InChIKey | OMHAYXHNXINYPG-INIZCTEOSA-N |
| XLogP | 5.09 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |