C12H16N2O — CID 135773162
N,N-dimethylnaphthalen-1-amine;hydroxylamine (PubChem CID 135773162) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is N,N-dimethylnaphthalen-1-amine;hydroxylamine.
| Compound Name | N,N-dimethylnaphthalen-1-amine;hydroxylamine |
|---|---|
| PubChem CID | 135773162 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | N,N-dimethylnaphthalen-1-amine;hydroxylamine |
| SMILES | CN(C)c1cccc2ccccc12.NO |
| InChI | InChI=1S/C12H13N.H3NO/c1-13(2)12-9-5-7-10-6-3-4-8-11(10)12;1-2/h3-9H,1-2H3;2H,1H2 |
| InChIKey | GDDNPFFRHXCPKI-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|