C12H15NO4S — CID 159908177
N,N-dimethylnaphthalen-1-amine;sulfuric acid (PubChem CID 159908177) has the molecular formula C12H15NO4S and a molecular weight of 269.32 g/mol. Its IUPAC name is N,N-dimethylnaphthalen-1-amine;sulfuric acid.
| Compound Name | N,N-dimethylnaphthalen-1-amine;sulfuric acid |
|---|---|
| PubChem CID | 159908177 |
| Molecular Formula | C12H15NO4S |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | N,N-dimethylnaphthalen-1-amine;sulfuric acid |
| SMILES | CN(C)c1cccc2ccccc12.O=S(=O)(O)O |
| InChI | InChI=1S/C12H13N.H2O4S/c1-13(2)12-9-5-7-10-6-3-4-8-11(10)12;1-5(2,3)4/h3-9H,1-2H3;(H2,1,2,3,4) |
| InChIKey | NWVMPYIDXWZLMU-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|