C12H14NNaO3S — CID 173060733
sodium;5-(dimethylamino)naphthalene-1-sulfonic acid;hydride (PubChem CID 173060733) has the molecular formula C12H14NNaO3S and a molecular weight of 275.31 g/mol. Its IUPAC name is sodium;5-(dimethylamino)naphthalene-1-sulfonic acid;hydride.
| Compound Name | sodium;5-(dimethylamino)naphthalene-1-sulfonic acid;hydride |
|---|---|
| PubChem CID | 173060733 |
| Molecular Formula | C12H14NNaO3S |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | sodium;5-(dimethylamino)naphthalene-1-sulfonic acid;hydride |
| SMILES | CN(C)c1cccc2c(S(=O)(=O)O)cccc12.[H-].[Na+] |
| InChI | InChI=1S/C12H13NO3S.Na.H/c1-13(2)11-7-3-6-10-9(11)5-4-8-12(10)17(14,15)16;;/h3-8H,1-2H3,(H,14,15,16);;/q;+1;-1 |
| InChIKey | YZCBHZICYUBTPX-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|