C15H18N2O2S3 — CID 3661171
[5-(dimethylamino)naphthalen-1-yl]sulfonyl N,N-dimethylcarbamodithioate (PubChem CID 3661171) has the molecular formula C15H18N2O2S3 and a molecular weight of 354.52 g/mol. Its IUPAC name is [5-(dimethylamino)naphthalen-1-yl]sulfonyl N,N-dimethylcarbamodithioate.
| Compound Name | [5-(dimethylamino)naphthalen-1-yl]sulfonyl N,N-dimethylcarbamodithioate |
|---|---|
| PubChem CID | 3661171 |
| Molecular Formula | C15H18N2O2S3 |
| Molecular Weight | 354.52 g/mol |
| Exact Mass | 354.05 |
| IUPAC Name | [5-(dimethylamino)naphthalen-1-yl]sulfonyl N,N-dimethylcarbamodithioate |
| SMILES | CN(C)C(=S)SS(=O)(=O)c1cccc2c(N(C)C)cccc12 |
| InChI | InChI=1S/C15H18N2O2S3/c1-16(2)13-9-5-8-12-11(13)7-6-10-14(12)22(18,19)21-15(20)17(3)4/h5-10H,1-4H3 |
| InChIKey | GHNWRZANBUWSOU-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.52 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|