About 2-aminophenol;5-(dimethylamino)naphthalene-1-sulfonyl chloride
2-aminophenol;5-(dimethylamino)naphthalene-1-sulfonyl chloride (PubChem CID 175398117) has the molecular formula C18H19ClN2O3S
and a molecular weight of 378.88 g/mol. Its IUPAC name is 2-aminophenol;5-(dimethylamino)naphthalene-1-sulfonyl chloride.
Molecular Properties
| Compound Name | 2-aminophenol;5-(dimethylamino)naphthalene-1-sulfonyl chloride |
| PubChem CID | 175398117 |
| Molecular Formula | C18H19ClN2O3S |
| Molecular Weight | 378.88 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | 2-aminophenol;5-(dimethylamino)naphthalene-1-sulfonyl chloride |
| SMILES | CN(C)c1cccc2c(S(=O)(=O)Cl)cccc12.Nc1ccccc1O |
| InChI | InChI=1S/C12H12ClNO2S.C6H7NO/c1-14(2)11-7-3-6-10-9(11)5-4-8-12(10)17(13,15)16;7-5-3-1-2-4-6(5)8/h3-8H,1-2H3;1-4,8H,7H2 |
| InChIKey | BGYDBLAQKGELGI-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.88 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 2-aminophenol;5-(dimethylamino)naphthalene-1-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminophenol;5-(dimethylamino)naphthalene-1-sulfonyl chloride?
The IUPAC name of 2-aminophenol;5-(dimethylamino)naphthalene-1-sulfonyl chloride (CID 175398117) is 2-aminophenol;5-(dimethylamino)naphthalene-1-sulfonyl chloride.
What is the SMILES notation for 2-aminophenol;5-(dimethylamino)naphthalene-1-sulfonyl chloride?
The canonical SMILES for 2-aminophenol;5-(dimethylamino)naphthalene-1-sulfonyl chloride is CN(C)c1cccc2c(S(=O)(=O)Cl)cccc12.Nc1ccccc1O.
What is the InChIKey of 2-aminophenol;5-(dimethylamino)naphthalene-1-sulfonyl chloride?
The InChIKey is BGYDBLAQKGELGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12ClNO2S.C6H7NO/c1-14(2)11-7-3-6-10-9(11)5-4-8-12(10)17(13,15)16;7-5-3-1-2-4-6(5)8/h3-8H,1-2H3;1-4,8H,7H2.
What are the key properties of 2-aminophenol;5-(dimethylamino)naphthalene-1-sulfonyl chloride?
2-aminophenol;5-(dimethylamino)naphthalene-1-sulfonyl chloride has a molecular weight of 378.88 g/mol, XLogP of 3.81, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminophenol;5-(dimethylamino)naphthalene-1-sulfonyl chloride is sourced from PubChem (CID 175398117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).