C22H19ClN2O4S2 — CID 71401329
5-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]naphthalene-1-sulfonyl chloride (PubChem CID 71401329) has the molecular formula C22H19ClN2O4S2 and a molecular weight of 474.99 g/mol. Its IUPAC name is 5-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]naphthalene-1-sulfonyl chloride.
| Compound Name | 5-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]naphthalene-1-sulfonyl chloride |
|---|---|
| PubChem CID | 71401329 |
| Molecular Formula | C22H19ClN2O4S2 |
| Molecular Weight | 474.99 g/mol |
| Exact Mass | 474.05 |
| IUPAC Name | 5-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]naphthalene-1-sulfonyl chloride |
| SMILES | CN(C)c1cccc2c(S(=O)(=O)Nc3cccc4c(S(=O)(=O)Cl)cccc34)cccc12 |
| InChI | InChI=1S/C22H19ClN2O4S2/c1-25(2)20-12-4-10-18-16(20)8-6-14-22(18)31(28,29)24-19-11-3-9-17-15(19)7-5-13-21(17)30(23,26)27/h3-14,24H,1-2H3 |
| InChIKey | NVTRAILFGPTQQG-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.99 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |