C18H19BN2O4S — CID 15345457
[4-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]phenyl]boronic acid (PubChem CID 15345457) has the molecular formula C18H19BN2O4S and a molecular weight of 370.24 g/mol. Its IUPAC name is [4-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]phenyl]boronic acid.
| Compound Name | [4-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]phenyl]boronic acid |
|---|---|
| PubChem CID | 15345457 |
| Molecular Formula | C18H19BN2O4S |
| Molecular Weight | 370.24 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | [4-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]phenyl]boronic acid |
| SMILES | CN(C)c1cccc2c(S(=O)(=O)Nc3ccc(B(O)O)cc3)cccc12 |
| InChI | InChI=1S/C18H19BN2O4S/c1-21(2)17-7-3-6-16-15(17)5-4-8-18(16)26(24,25)20-14-11-9-13(10-12-14)19(22)23/h3-12,20,22-23H,1-2H3 |
| InChIKey | NCPSZGPOSNSMDZ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.24 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|