C36H34BN4O6S2 — CID 57189636
CID 57189636 (PubChem CID 57189636) has the molecular formula C36H34BN4O6S2 and a molecular weight of 693.64 g/mol.
| Compound Name | CID 57189636 |
|---|---|
| PubChem CID | 57189636 |
| Molecular Formula | C36H34BN4O6S2 |
| Molecular Weight | 693.64 g/mol |
| Exact Mass | 693.20 |
| IUPAC Name | — |
| SMILES | CN(C)c1cccc2c(S(=O)(=O)Nc3cccc(O[B]Oc4cccc(NS(=O)(=O)c5cccc6c(N(C)C)cccc56)c4)c3)cccc12 |
| InChI | InChI=1S/C36H34BN4O6S2/c1-40(2)33-19-7-17-31-29(33)15-9-21-35(31)48(42,43)38-25-11-5-13-27(23-25)46-37-47-28-14-6-12-26(24-28)39-49(44,45)36-22-10-16-30-32(36)18-8-20-34(30)41(3)4/h5-24,38-39H,1-4H3 |
| InChIKey | OYKHIHFAWMISNG-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 117.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.64 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|