C15H15IN2O2S — CID 170856983
5-(dimethylamino)-N-(3-iodoprop-2-ynyl)naphthalene-1-sulfonamide (PubChem CID 170856983) has the molecular formula C15H15IN2O2S and a molecular weight of 414.27 g/mol. Its IUPAC name is 5-(dimethylamino)-N-(3-iodoprop-2-ynyl)naphthalene-1-sulfonamide.
| Compound Name | 5-(dimethylamino)-N-(3-iodoprop-2-ynyl)naphthalene-1-sulfonamide |
|---|---|
| PubChem CID | 170856983 |
| Molecular Formula | C15H15IN2O2S |
| Molecular Weight | 414.27 g/mol |
| Exact Mass | 413.99 |
| IUPAC Name | 5-(dimethylamino)-N-(3-iodoprop-2-ynyl)naphthalene-1-sulfonamide |
| SMILES | CN(C)c1cccc2c(S(=O)(=O)NCC#CI)cccc12 |
| InChI | InChI=1S/C15H15IN2O2S/c1-18(2)14-8-3-7-13-12(14)6-4-9-15(13)21(19,20)17-11-5-10-16/h3-4,6-9,17H,11H2,1-2H3 |
| InChIKey | DLCRDTZDCZIFIO-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.27 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|