C13H17N2O5PS — CID 10641161
[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]methylphosphonic acid (PubChem CID 10641161) has the molecular formula C13H17N2O5PS and a molecular weight of 344.33 g/mol. Its IUPAC name is [[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]methylphosphonic acid.
| Compound Name | [[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]methylphosphonic acid |
|---|---|
| PubChem CID | 10641161 |
| Molecular Formula | C13H17N2O5PS |
| Molecular Weight | 344.33 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | [[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]methylphosphonic acid |
| SMILES | CN(C)c1cccc2c(S(=O)(=O)NCP(=O)(O)O)cccc12 |
| InChI | InChI=1S/C13H17N2O5PS/c1-15(2)12-7-3-6-11-10(12)5-4-8-13(11)22(19,20)14-9-21(16,17)18/h3-8,14H,9H2,1-2H3,(H2,16,17,18) |
| InChIKey | IMUBWNWNTJGWRQ-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.33 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|