C13H12ClNO2S — CID 123694795
5-[ethenyl(methyl)amino]naphthalene-1-sulfonyl chloride (PubChem CID 123694795) has the molecular formula C13H12ClNO2S and a molecular weight of 281.76 g/mol. Its IUPAC name is 5-[ethenyl(methyl)amino]naphthalene-1-sulfonyl chloride.
| Compound Name | 5-[ethenyl(methyl)amino]naphthalene-1-sulfonyl chloride |
|---|---|
| PubChem CID | 123694795 |
| Molecular Formula | C13H12ClNO2S |
| Molecular Weight | 281.76 g/mol |
| Exact Mass | 281.03 |
| IUPAC Name | 5-[ethenyl(methyl)amino]naphthalene-1-sulfonyl chloride |
| SMILES | C=CN(C)c1cccc2c(S(=O)(=O)Cl)cccc12 |
| InChI | InChI=1S/C13H12ClNO2S/c1-3-15(2)12-8-4-7-11-10(12)6-5-9-13(11)18(14,16)17/h3-9H,1H2,2H3 |
| InChIKey | QOMYOKWCEOPCMD-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.76 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |