C38H33Cl6N2O9PS2 — CID 167635460
benzyl N-(5-chlorosulfonylnaphthalen-1-yl)-N-methylcarbamate;5-[methyl(phenylmethoxycarbonyl)amino]naphthalene-1-sulfonic acid;pentachloro-λ5-phosphane (PubChem CID 167635460) has the molecular formula C38H33Cl6N2O9PS2 and a molecular weight of 969.51 g/mol. Its IUPAC name is benzyl N-(5-chlorosulfonylnaphthalen-1-yl)-N-methylcarbamate;5-[methyl(phenylmethoxycarbonyl)amino]naphthalene-1-sulfonic acid;pentachloro-λ5-phosphane.
| Compound Name | benzyl N-(5-chlorosulfonylnaphthalen-1-yl)-N-methylcarbamate;5-[methyl(phenylmethoxycarbonyl)amino]naphthalene-1-sulfonic acid;pentachloro-λ5-phosphane |
|---|---|
| PubChem CID | 167635460 |
| Molecular Formula | C38H33Cl6N2O9PS2 |
| Molecular Weight | 969.51 g/mol |
| Exact Mass | 965.95 |
| IUPAC Name | benzyl N-(5-chlorosulfonylnaphthalen-1-yl)-N-methylcarbamate;5-[methyl(phenylmethoxycarbonyl)amino]naphthalene-1-sulfonic acid;pentachloro-λ5-phosphane |
| SMILES | CN(C(=O)OCc1ccccc1)c1cccc2c(S(=O)(=O)Cl)cccc12.CN(C(=O)OCc1ccccc1)c1cccc2c(S(=O)(=O)O)cccc12.ClP(Cl)(Cl)(Cl)Cl |
| InChI | InChI=1S/C19H16ClNO4S.C19H17NO5S.Cl5P/c1-21(19(22)25-13-14-7-3-2-4-8-14)17-11-5-10-16-15(17)9-6-12-18(16)26(20,23)24;1-20(19(21)25-13-14-7-3-2-4-8-14)17-11-5-10-16-15(17)9-6-12-18(16)26(22,23)24;1-6(2,3,4)5/h2-12H,13H2,1H3;2-12H,13H2,1H3,(H,22,23,24); |
| InChIKey | OKKGUVJGKKBGJA-UHFFFAOYSA-N |
| XLogP | 12.71 |
| TPSA | 147.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 969.51 |
| LogP ≤ 5 | 12.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|