C30H30N2O6S — CID 101007079
benzyl N-benzyl-N-[(2-methylpropan-2-yl)oxycarbonyl-naphthalen-1-ylsulfonylamino]carbamate (PubChem CID 101007079) has the molecular formula C30H30N2O6S and a molecular weight of 546.65 g/mol. Its IUPAC name is benzyl N-benzyl-N-[(2-methylpropan-2-yl)oxycarbonyl-naphthalen-1-ylsulfonylamino]carbamate.
| Compound Name | benzyl N-benzyl-N-[(2-methylpropan-2-yl)oxycarbonyl-naphthalen-1-ylsulfonylamino]carbamate |
|---|---|
| PubChem CID | 101007079 |
| Molecular Formula | C30H30N2O6S |
| Molecular Weight | 546.65 g/mol |
| Exact Mass | 546.18 |
| IUPAC Name | benzyl N-benzyl-N-[(2-methylpropan-2-yl)oxycarbonyl-naphthalen-1-ylsulfonylamino]carbamate |
| SMILES | CC(C)(C)OC(=O)N(N(Cc1ccccc1)C(=O)OCc1ccccc1)S(=O)(=O)c1cccc2ccccc12 |
| InChI | InChI=1S/C30H30N2O6S/c1-30(2,3)38-29(34)32(39(35,36)27-20-12-18-25-17-10-11-19-26(25)27)31(21-23-13-6-4-7-14-23)28(33)37-22-24-15-8-5-9-16-24/h4-20H,21-22H2,1-3H3 |
| InChIKey | FGQHPLZMLRJAHC-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.65 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|