C15H20ClNO6S — CID 168920145
benzyl (2R)-2-[chlorosulfonyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoate (PubChem CID 168920145) has the molecular formula C15H20ClNO6S and a molecular weight of 377.85 g/mol. Its IUPAC name is benzyl (2R)-2-[chlorosulfonyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoate.
| Compound Name | benzyl (2R)-2-[chlorosulfonyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoate |
|---|---|
| PubChem CID | 168920145 |
| Molecular Formula | C15H20ClNO6S |
| Molecular Weight | 377.85 g/mol |
| Exact Mass | 377.07 |
| IUPAC Name | benzyl (2R)-2-[chlorosulfonyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoate |
| SMILES | C[C@H](C(=O)OCc1ccccc1)N(C(=O)OC(C)(C)C)S(=O)(=O)Cl |
| InChI | InChI=1S/C15H20ClNO6S/c1-11(13(18)22-10-12-8-6-5-7-9-12)17(24(16,20)21)14(19)23-15(2,3)4/h5-9,11H,10H2,1-4H3/t11-/m1/s1 |
| InChIKey | SJJPYYYCMHKBNB-LLVKDONJSA-N |
| XLogP | 2.84 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.85 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |