C19H29NO4 — CID 67291803
benzyl (2S)-2-[ethyl-[1-[(2-methylpropan-2-yl)oxy]-1-oxopropan-2-yl]amino]propanoate (PubChem CID 67291803) has the molecular formula C19H29NO4 and a molecular weight of 335.44 g/mol. Its IUPAC name is benzyl (2S)-2-[ethyl-[1-[(2-methylpropan-2-yl)oxy]-1-oxopropan-2-yl]amino]propanoate.
| Compound Name | benzyl (2S)-2-[ethyl-[1-[(2-methylpropan-2-yl)oxy]-1-oxopropan-2-yl]amino]propanoate |
|---|---|
| PubChem CID | 67291803 |
| Molecular Formula | C19H29NO4 |
| Molecular Weight | 335.44 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | benzyl (2S)-2-[ethyl-[1-[(2-methylpropan-2-yl)oxy]-1-oxopropan-2-yl]amino]propanoate |
| SMILES | CCN(C(C)C(=O)OC(C)(C)C)[C@@H](C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H29NO4/c1-7-20(15(3)18(22)24-19(4,5)6)14(2)17(21)23-13-16-11-9-8-10-12-16/h8-12,14-15H,7,13H2,1-6H3/t14-,15?/m0/s1 |
| InChIKey | WUAKNLUYPRECJC-MLCCFXAWSA-N |
| XLogP | 3.17 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.44 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |