C17H26N2O6S — CID 168920072
benzyl (2R)-2-[dimethylsulfamoyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoate (PubChem CID 168920072) has the molecular formula C17H26N2O6S and a molecular weight of 386.47 g/mol. Its IUPAC name is benzyl (2R)-2-[dimethylsulfamoyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoate.
| Compound Name | benzyl (2R)-2-[dimethylsulfamoyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoate |
|---|---|
| PubChem CID | 168920072 |
| Molecular Formula | C17H26N2O6S |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | benzyl (2R)-2-[dimethylsulfamoyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoate |
| SMILES | C[C@H](C(=O)OCc1ccccc1)N(C(=O)OC(C)(C)C)S(=O)(=O)N(C)C |
| InChI | InChI=1S/C17H26N2O6S/c1-13(15(20)24-12-14-10-8-7-9-11-14)19(26(22,23)18(5)6)16(21)25-17(2,3)4/h7-11,13H,12H2,1-6H3/t13-/m1/s1 |
| InChIKey | AFPJYBPAZMMPQW-CYBMUJFWSA-N |
| XLogP | 2.16 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |