C19H22N2O4 — CID 15499636
benzyl N-anilino-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate (PubChem CID 15499636) has the molecular formula C19H22N2O4 and a molecular weight of 342.39 g/mol. Its IUPAC name is benzyl N-anilino-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate.
| Compound Name | benzyl N-anilino-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
|---|---|
| PubChem CID | 15499636 |
| Molecular Formula | C19H22N2O4 |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | benzyl N-anilino-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(Nc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H22N2O4/c1-19(2,3)25-18(23)21(20-16-12-8-5-9-13-16)17(22)24-14-15-10-6-4-7-11-15/h4-13,20H,14H2,1-3H3 |
| InChIKey | NBJBDENBTVAQKC-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|