C27H33NO2 — CID 134918783
tert-butyl (3R)-3-[benzyl(propan-2-yl)amino]-3-naphthalen-1-ylpropanoate (PubChem CID 134918783) has the molecular formula C27H33NO2 and a molecular weight of 403.57 g/mol. Its IUPAC name is tert-butyl (3R)-3-[benzyl(propan-2-yl)amino]-3-naphthalen-1-ylpropanoate.
| Compound Name | tert-butyl (3R)-3-[benzyl(propan-2-yl)amino]-3-naphthalen-1-ylpropanoate |
|---|---|
| PubChem CID | 134918783 |
| Molecular Formula | C27H33NO2 |
| Molecular Weight | 403.57 g/mol |
| Exact Mass | 403.25 |
| IUPAC Name | tert-butyl (3R)-3-[benzyl(propan-2-yl)amino]-3-naphthalen-1-ylpropanoate |
| SMILES | CC(C)N(Cc1ccccc1)[C@H](CC(=O)OC(C)(C)C)c1cccc2ccccc12 |
| InChI | InChI=1S/C27H33NO2/c1-20(2)28(19-21-12-7-6-8-13-21)25(18-26(29)30-27(3,4)5)24-17-11-15-22-14-9-10-16-23(22)24/h6-17,20,25H,18-19H2,1-5H3/t25-/m1/s1 |
| InChIKey | XDESUHLAGGVZSX-RUZDIDTESA-N |
| XLogP | 6.52 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.57 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |