C23H25NO4S — CID 68507397
tert-butyl N-[benzenesulfonyl(naphthalen-1-yl)methyl]-N-methylcarbamate (PubChem CID 68507397) has the molecular formula C23H25NO4S and a molecular weight of 411.52 g/mol. Its IUPAC name is tert-butyl N-[benzenesulfonyl(naphthalen-1-yl)methyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[benzenesulfonyl(naphthalen-1-yl)methyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 68507397 |
| Molecular Formula | C23H25NO4S |
| Molecular Weight | 411.52 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | tert-butyl N-[benzenesulfonyl(naphthalen-1-yl)methyl]-N-methylcarbamate |
| SMILES | CN(C(=O)OC(C)(C)C)C(c1cccc2ccccc12)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C23H25NO4S/c1-23(2,3)28-22(25)24(4)21(29(26,27)18-13-6-5-7-14-18)20-16-10-12-17-11-8-9-15-19(17)20/h5-16,21H,1-4H3 |
| InChIKey | KXCBXLJQTZUJMA-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.52 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |